C8H12ClN5 — CID 11970858
6-chloro-2-N-cyclopentyl-1,3,5-triazine-2,4-diamine (PubChem CID 11970858) has the molecular formula C8H12ClN5 and a molecular weight of 213.67 g/mol. Its IUPAC name is 6-chloro-2-N-cyclopentyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-cyclopentyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11970858 |
| Molecular Formula | C8H12ClN5 |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 6-chloro-2-N-cyclopentyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Cl)nc(NC2CCCC2)n1 |
| InChI | InChI=1S/C8H12ClN5/c9-6-12-7(10)14-8(13-6)11-5-3-1-2-4-5/h5H,1-4H2,(H3,10,11,12,13,14) |
| InChIKey | AMEQGMVFTOUTHW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |