C7H10ClN5 — CID 80827381
6-chloro-2-N-cyclobutyl-1,3,5-triazine-2,4-diamine (PubChem CID 80827381) has the molecular formula C7H10ClN5 and a molecular weight of 199.64 g/mol. Its IUPAC name is 6-chloro-2-N-cyclobutyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-cyclobutyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80827381 |
| Molecular Formula | C7H10ClN5 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 6-chloro-2-N-cyclobutyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Cl)nc(NC2CCC2)n1 |
| InChI | InChI=1S/C7H10ClN5/c8-5-11-6(9)13-7(12-5)10-4-2-1-3-4/h4H,1-3H2,(H3,9,10,11,12,13) |
| InChIKey | NTAHPORHAPXFRI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |