C10H16ClN5 — CID 80773525
6-chloro-2-N-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80773525) has the molecular formula C10H16ClN5 and a molecular weight of 241.73 g/mol. Its IUPAC name is 6-chloro-2-N-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80773525 |
| Molecular Formula | C10H16ClN5 |
| Molecular Weight | 241.73 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-chloro-2-N-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1CCC(Nc2nc(N)nc(Cl)n2)CC1 |
| InChI | InChI=1S/C10H16ClN5/c1-6-2-4-7(5-3-6)13-10-15-8(11)14-9(12)16-10/h6-7H,2-5H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | KYJPAEPLIQQRHK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |