C8H10Cl2N4O — CID 62868886
4,6-dichloro-N-(oxan-4-yl)-1,3,5-triazin-2-amine (PubChem CID 62868886) has the molecular formula C8H10Cl2N4O and a molecular weight of 249.10 g/mol. Its IUPAC name is 4,6-dichloro-N-(oxan-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(oxan-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62868886 |
| Molecular Formula | C8H10Cl2N4O |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 4,6-dichloro-N-(oxan-4-yl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(NC2CCOCC2)n1 |
| InChI | InChI=1S/C8H10Cl2N4O/c9-6-12-7(10)14-8(13-6)11-5-1-3-15-4-2-5/h5H,1-4H2,(H,11,12,13,14) |
| InChIKey | UBAJNGYNJRXPQY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |