C7H8Cl2N4S — CID 103064279
4,6-dichloro-N-(thiolan-3-yl)-1,3,5-triazin-2-amine (PubChem CID 103064279) has the molecular formula C7H8Cl2N4S and a molecular weight of 251.14 g/mol. Its IUPAC name is 4,6-dichloro-N-(thiolan-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(thiolan-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103064279 |
| Molecular Formula | C7H8Cl2N4S |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 4,6-dichloro-N-(thiolan-3-yl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(NC2CCSC2)n1 |
| InChI | InChI=1S/C7H8Cl2N4S/c8-5-11-6(9)13-7(12-5)10-4-1-2-14-3-4/h4H,1-3H2,(H,10,11,12,13) |
| InChIKey | CPSYENHCSBTRBJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |