C12H14ClN3S2 — CID 103322745
2-chloro-6-ethyl-N-(thiolan-3-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103322745) has the molecular formula C12H14ClN3S2 and a molecular weight of 299.85 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-(thiolan-3-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-ethyl-N-(thiolan-3-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103322745 |
| Molecular Formula | C12H14ClN3S2 |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-chloro-6-ethyl-N-(thiolan-3-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NC3CCSC3)nc(Cl)nc2s1 |
| InChI | InChI=1S/C12H14ClN3S2/c1-2-8-5-9-10(14-7-3-4-17-6-7)15-12(13)16-11(9)18-8/h5,7H,2-4,6H2,1H3,(H,14,15,16) |
| InChIKey | ZMSZXXRLVMZXSH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |