C12H16N4S — CID 103327219
4-N-cyclobutyl-6-ethylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103327219) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-N-cyclobutyl-6-ethylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclobutyl-6-ethylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103327219 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-N-cyclobutyl-6-ethylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCc1cc2c(NC3CCC3)nc(N)nc2s1 |
| InChI | InChI=1S/C12H16N4S/c1-2-8-6-9-10(14-7-4-3-5-7)15-12(13)16-11(9)17-8/h6-7H,2-5H2,1H3,(H3,13,14,15,16) |
| InChIKey | GHXUFYWIVVZXTH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |