C14H22N4S — CID 103328125
6-ethyl-4-N-hexylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103328125) has the molecular formula C14H22N4S and a molecular weight of 278.43 g/mol. Its IUPAC name is 6-ethyl-4-N-hexylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-4-N-hexylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103328125 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 6-ethyl-4-N-hexylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCCNc1nc(N)nc2sc(CC)cc12 |
| InChI | InChI=1S/C14H22N4S/c1-3-5-6-7-8-16-12-11-9-10(4-2)19-13(11)18-14(15)17-12/h9H,3-8H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | WRBCXYYEONYGQR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|