C12H16N4S2 — CID 103330885
6-ethyl-4-N-(thiolan-3-yl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103330885) has the molecular formula C12H16N4S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 6-ethyl-4-N-(thiolan-3-yl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-4-N-(thiolan-3-yl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103330885 |
| Molecular Formula | C12H16N4S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-ethyl-4-N-(thiolan-3-yl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCc1cc2c(NC3CCSC3)nc(N)nc2s1 |
| InChI | InChI=1S/C12H16N4S2/c1-2-8-5-9-10(14-7-3-4-17-6-7)15-12(13)16-11(9)18-8/h5,7H,2-4,6H2,1H3,(H3,13,14,15,16) |
| InChIKey | FEVNXBFOBKERFC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |