C14H18ClN3OS — CID 103321723
2-chloro-6-ethyl-N-(oxan-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103321723) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-(oxan-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-ethyl-N-(oxan-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103321723 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-chloro-6-ethyl-N-(oxan-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCC3CCOCC3)nc(Cl)nc2s1 |
| InChI | InChI=1S/C14H18ClN3OS/c1-2-10-7-11-12(17-14(15)18-13(11)20-10)16-8-9-3-5-19-6-4-9/h7,9H,2-6,8H2,1H3,(H,16,17,18) |
| InChIKey | AWJRCORIQVLGAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |