C13H19N5OS — CID 103333481
6-ethyl-2-hydrazinyl-N-(oxolan-3-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103333481) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 6-ethyl-2-hydrazinyl-N-(oxolan-3-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-hydrazinyl-N-(oxolan-3-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103333481 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 6-ethyl-2-hydrazinyl-N-(oxolan-3-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCC3CCOC3)nc(NN)nc2s1 |
| InChI | InChI=1S/C13H19N5OS/c1-2-9-5-10-11(15-6-8-3-4-19-7-8)16-13(18-14)17-12(10)20-9/h5,8H,2-4,6-7,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | MTUIJTXQOSDRHT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|