C14H21N5S2 — CID 103334706
6-ethyl-2-hydrazinyl-N-(thian-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103334706) has the molecular formula C14H21N5S2 and a molecular weight of 323.49 g/mol. Its IUPAC name is 6-ethyl-2-hydrazinyl-N-(thian-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-hydrazinyl-N-(thian-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103334706 |
| Molecular Formula | C14H21N5S2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 6-ethyl-2-hydrazinyl-N-(thian-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCC3CCCCS3)nc(NN)nc2s1 |
| InChI | InChI=1S/C14H21N5S2/c1-2-9-7-11-12(16-8-10-5-3-4-6-20-10)17-14(19-15)18-13(11)21-9/h7,10H,2-6,8,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | RBRDNWWTFYWUSE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|