C6H6Cl2N4 — CID 22254066
4,6-dichloro-N-cyclopropyl-1,3,5-triazin-2-amine (PubChem CID 22254066) has the molecular formula C6H6Cl2N4 and a molecular weight of 205.05 g/mol. Its IUPAC name is 4,6-dichloro-N-cyclopropyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-cyclopropyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 22254066 |
| Molecular Formula | C6H6Cl2N4 |
| Molecular Weight | 205.05 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 4,6-dichloro-N-cyclopropyl-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(NC2CC2)n1 |
| InChI | InChI=1S/C6H6Cl2N4/c7-4-10-5(8)12-6(11-4)9-3-1-2-3/h3H,1-2H2,(H,9,10,11,12) |
| InChIKey | BFZPFVIKDQXXKY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.05 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |