C10H12N4S — CID 107545432
6-methyl-2-(thiolan-3-ylamino)pyrimidine-4-carbonitrile (PubChem CID 107545432) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 6-methyl-2-(thiolan-3-ylamino)pyrimidine-4-carbonitrile.
| Compound Name | 6-methyl-2-(thiolan-3-ylamino)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545432 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 6-methyl-2-(thiolan-3-ylamino)pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NC2CCSC2)n1 |
| InChI | InChI=1S/C10H12N4S/c1-7-4-9(5-11)14-10(12-7)13-8-2-3-15-6-8/h4,8H,2-3,6H2,1H3,(H,12,13,14) |
| InChIKey | HTTKAJSAFCWSSW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |