C12H16N4 — CID 107545210
2-(2-cyclopropylpropylamino)-6-methylpyrimidine-4-carbonitrile (PubChem CID 107545210) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-(2-cyclopropylpropylamino)-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(2-cyclopropylpropylamino)-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545210 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-(2-cyclopropylpropylamino)-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NCC(C)C2CC2)n1 |
| InChI | InChI=1S/C12H16N4/c1-8(10-3-4-10)7-14-12-15-9(2)5-11(6-13)16-12/h5,8,10H,3-4,7H2,1-2H3,(H,14,15,16) |
| InChIKey | TUNJCXQJOFKBMC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |