C11H16N4O — CID 107545273
2-(3-hydroxypentylamino)-6-methylpyrimidine-4-carbonitrile (PubChem CID 107545273) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-(3-hydroxypentylamino)-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(3-hydroxypentylamino)-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545273 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(3-hydroxypentylamino)-6-methylpyrimidine-4-carbonitrile |
| SMILES | CCC(O)CCNc1nc(C)cc(C#N)n1 |
| InChI | InChI=1S/C11H16N4O/c1-3-10(16)4-5-13-11-14-8(2)6-9(7-12)15-11/h6,10,16H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | PPTKRDBXEQCMTP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |