C10H14N4OS — CID 107545250
6-methyl-2-(3-methylsulfinylpropylamino)pyrimidine-4-carbonitrile (PubChem CID 107545250) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 6-methyl-2-(3-methylsulfinylpropylamino)pyrimidine-4-carbonitrile.
| Compound Name | 6-methyl-2-(3-methylsulfinylpropylamino)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545250 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-methyl-2-(3-methylsulfinylpropylamino)pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NCCCS(C)=O)n1 |
| InChI | InChI=1S/C10H14N4OS/c1-8-6-9(7-11)14-10(13-8)12-4-3-5-16(2)15/h6H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | VVACJHDTOGSVBI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|