C13H20N6 — CID 107551946
6-methyl-2-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidine-4-carbonitrile (PubChem CID 107551946) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-methyl-2-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidine-4-carbonitrile.
| Compound Name | 6-methyl-2-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107551946 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 6-methyl-2-[2-(4-methylpiperazin-1-yl)ethylamino]pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NCCN2CCN(C)CC2)n1 |
| InChI | InChI=1S/C13H20N6/c1-11-9-12(10-14)17-13(16-11)15-3-4-19-7-5-18(2)6-8-19/h9H,3-8H2,1-2H3,(H,15,16,17) |
| InChIKey | WARXLCOTWZVCHT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |