C10H15N5 — CID 110383441
2-[2-(dimethylamino)ethylamino]-6-methylpyrimidine-4-carbonitrile (PubChem CID 110383441) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-[2-(dimethylamino)ethylamino]-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 110383441 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NCCN(C)C)n1 |
| InChI | InChI=1S/C10H15N5/c1-8-6-9(7-11)14-10(13-8)12-4-5-15(2)3/h6H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | WEJFICZAGUHBBA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |