C11H16N4 — CID 107543261
6-methyl-2-(2-methylbutan-2-ylamino)pyrimidine-4-carbonitrile (PubChem CID 107543261) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 6-methyl-2-(2-methylbutan-2-ylamino)pyrimidine-4-carbonitrile.
| Compound Name | 6-methyl-2-(2-methylbutan-2-ylamino)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107543261 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 6-methyl-2-(2-methylbutan-2-ylamino)pyrimidine-4-carbonitrile |
| SMILES | CCC(C)(C)Nc1nc(C)cc(C#N)n1 |
| InChI | InChI=1S/C11H16N4/c1-5-11(3,4)15-10-13-8(2)6-9(7-12)14-10/h6H,5H2,1-4H3,(H,13,14,15) |
| InChIKey | MQIWETQQRFHVSU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |