C11H14N4O2 — CID 107543089
2-[(4-cyano-6-methylpyrimidin-2-yl)amino]-2-methylbutanoic acid (PubChem CID 107543089) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-[(4-cyano-6-methylpyrimidin-2-yl)amino]-2-methylbutanoic acid.
| Compound Name | 2-[(4-cyano-6-methylpyrimidin-2-yl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 107543089 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-[(4-cyano-6-methylpyrimidin-2-yl)amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(Nc1nc(C)cc(C#N)n1)C(=O)O |
| InChI | InChI=1S/C11H14N4O2/c1-4-11(3,9(16)17)15-10-13-7(2)5-8(6-12)14-10/h5H,4H2,1-3H3,(H,16,17)(H,13,14,15) |
| InChIKey | JWAKLKPVPDNHID-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |