C15H24N4 — CID 107544876
2-(2,2-dimethylheptylamino)-6-methylpyrimidine-4-carbonitrile (PubChem CID 107544876) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(2,2-dimethylheptylamino)-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(2,2-dimethylheptylamino)-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107544876 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-(2,2-dimethylheptylamino)-6-methylpyrimidine-4-carbonitrile |
| SMILES | CCCCCC(C)(C)CNc1nc(C)cc(C#N)n1 |
| InChI | InChI=1S/C15H24N4/c1-5-6-7-8-15(3,4)11-17-14-18-12(2)9-13(10-16)19-14/h9H,5-8,11H2,1-4H3,(H,17,18,19) |
| InChIKey | NGQWDZVPFXXWMW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|