C13H17F3N4S2 — CID 75422707
2-N,4-N-bis(thiolan-3-yl)-6-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 75422707) has the molecular formula C13H17F3N4S2 and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-N,4-N-bis(thiolan-3-yl)-6-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(thiolan-3-yl)-6-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 75422707 |
| Molecular Formula | C13H17F3N4S2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-N,4-N-bis(thiolan-3-yl)-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)c1cc(NC2CCSC2)nc(NC2CCSC2)n1 |
| InChI | InChI=1S/C13H17F3N4S2/c14-13(15,16)10-5-11(17-8-1-3-21-6-8)20-12(19-10)18-9-2-4-22-7-9/h5,8-9H,1-4,6-7H2,(H2,17,18,19,20) |
| InChIKey | ZNTAMOXBMKXAIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |