C9H10F3N3S — CID 103880258
N-(thiolan-3-yl)-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 103880258) has the molecular formula C9H10F3N3S and a molecular weight of 249.26 g/mol. Its IUPAC name is N-(thiolan-3-yl)-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-(thiolan-3-yl)-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 103880258 |
| Molecular Formula | C9H10F3N3S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-(thiolan-3-yl)-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | FC(F)(F)c1ccc(NC2CCSC2)nn1 |
| InChI | InChI=1S/C9H10F3N3S/c10-9(11,12)7-1-2-8(15-14-7)13-6-3-4-16-5-6/h1-2,6H,3-5H2,(H,13,15) |
| InChIKey | MSKLOFBQRYSNFM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |