C11H16N4OS — CID 103063431
N,N-dimethyl-6-(thiolan-3-ylamino)pyridazine-3-carboxamide (PubChem CID 103063431) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is N,N-dimethyl-6-(thiolan-3-ylamino)pyridazine-3-carboxamide.
| Compound Name | N,N-dimethyl-6-(thiolan-3-ylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103063431 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N,N-dimethyl-6-(thiolan-3-ylamino)pyridazine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NC2CCSC2)nn1 |
| InChI | InChI=1S/C11H16N4OS/c1-15(2)11(16)9-3-4-10(14-13-9)12-8-5-6-17-7-8/h3-4,8H,5-7H2,1-2H3,(H,12,14) |
| InChIKey | BAUFPDBZSOGWMM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |