C9H11N3O2 — CID 60792451
methyl 6-(cyclopropylamino)pyridazine-3-carboxylate (PubChem CID 60792451) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is methyl 6-(cyclopropylamino)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(cyclopropylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 60792451 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | methyl 6-(cyclopropylamino)pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC2CC2)nn1 |
| InChI | InChI=1S/C9H11N3O2/c1-14-9(13)7-4-5-8(12-11-7)10-6-2-3-6/h4-6H,2-3H2,1H3,(H,10,12) |
| InChIKey | MLOPZFQAFNLXHH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |