C11H15N3O4S — CID 60791668
methyl 6-[(1,1-dioxothian-4-yl)amino]pyridazine-3-carboxylate (PubChem CID 60791668) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 6-[(1,1-dioxothian-4-yl)amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(1,1-dioxothian-4-yl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 60791668 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl 6-[(1,1-dioxothian-4-yl)amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC2CCS(=O)(=O)CC2)nn1 |
| InChI | InChI=1S/C11H15N3O4S/c1-18-11(15)9-2-3-10(14-13-9)12-8-4-6-19(16,17)7-5-8/h2-3,8H,4-7H2,1H3,(H,12,14) |
| InChIKey | FACJSJPXWCHUHN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |