C10H13N3O2S — CID 103704261
methyl 6-(thiolan-3-ylamino)pyridazine-3-carboxylate (PubChem CID 103704261) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is methyl 6-(thiolan-3-ylamino)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(thiolan-3-ylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 103704261 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | methyl 6-(thiolan-3-ylamino)pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC2CCSC2)nn1 |
| InChI | InChI=1S/C10H13N3O2S/c1-15-10(14)8-2-3-9(13-12-8)11-7-4-5-16-6-7/h2-3,7H,4-6H2,1H3,(H,11,13) |
| InChIKey | DMOMPFJJTRNRRC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |