C10H13N3O4S — CID 66457874
methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate (PubChem CID 66457874) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66457874 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H13N3O4S/c1-17-10(14)8-4-11-5-9(13-8)12-7-2-3-18(15,16)6-7/h4-5,7H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | SYBKEMSJLHTQRV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |