methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate

C10H13N3O4S — CID 66457874

IUPACmethyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(NC2CCS(=O)(=O)C2)n1
InChIInChI=1S/C10H13N3O4S/c1-17-10(14)8-4-11-5-9(13-8)12-7-2-3-18(15,16)6-7/h4-5,7H,2-3,6H2,1H3,(H,12,13)
InChIKeySYBKEMSJLHTQRV-UHFFFAOYSA-N
MW271.30 g/mol
LogP-0.14
Rot. Bonds3

About methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate

methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate (PubChem CID 66457874) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate
PubChem CID66457874
Molecular FormulaC10H13N3O4S
Molecular Weight271.30 g/mol
Exact Mass271.06
IUPAC Namemethyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(NC2CCS(=O)(=O)C2)n1
InChIInChI=1S/C10H13N3O4S/c1-17-10(14)8-4-11-5-9(13-8)12-7-2-3-18(15,16)6-7/h4-5,7H,2-3,6H2,1H3,(H,12,13)
InChIKeySYBKEMSJLHTQRV-UHFFFAOYSA-N
XLogP-0.14
TPSA98.25 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.30
LogP ≤ 5-0.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate?
The IUPAC name of methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate (CID 66457874) is methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate is COC(=O)c1cncc(NC2CCS(=O)(=O)C2)n1.
What is the InChIKey of methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate?
The InChIKey is SYBKEMSJLHTQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4S/c1-17-10(14)8-4-11-5-9(13-8)12-7-2-3-18(15,16)6-7/h4-5,7H,2-3,6H2,1H3,(H,12,13).
What are the key properties of methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate?
methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate has a molecular weight of 271.30 g/mol, XLogP of -0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carboxylate is sourced from PubChem (CID 66457874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).