C12H18N4O2 — CID 66455915
methyl 6-[(1-methylpiperidin-3-yl)amino]pyrazine-2-carboxylate (PubChem CID 66455915) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is methyl 6-[(1-methylpiperidin-3-yl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[(1-methylpiperidin-3-yl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66455915 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | methyl 6-[(1-methylpiperidin-3-yl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NC2CCCN(C)C2)n1 |
| InChI | InChI=1S/C12H18N4O2/c1-16-5-3-4-9(8-16)14-11-7-13-6-10(15-11)12(17)18-2/h6-7,9H,3-5,8H2,1-2H3,(H,14,15) |
| InChIKey | RJKYYEYHRVDWLQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |