C11H14N4O3 — CID 66457122
methyl 6-[(6-oxopiperidin-3-yl)amino]pyrazine-2-carboxylate (PubChem CID 66457122) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is methyl 6-[(6-oxopiperidin-3-yl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[(6-oxopiperidin-3-yl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66457122 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | methyl 6-[(6-oxopiperidin-3-yl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NC2CCC(=O)NC2)n1 |
| InChI | InChI=1S/C11H14N4O3/c1-18-11(17)8-5-12-6-9(15-8)14-7-2-3-10(16)13-4-7/h5-7H,2-4H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | SDWWCADOEWKASR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |