C13H19N3O3 — CID 113394825
methyl 6-[(2-hydroxycycloheptyl)amino]pyrazine-2-carboxylate (PubChem CID 113394825) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 6-[(2-hydroxycycloheptyl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[(2-hydroxycycloheptyl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 113394825 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | methyl 6-[(2-hydroxycycloheptyl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NC2CCCCCC2O)n1 |
| InChI | InChI=1S/C13H19N3O3/c1-19-13(18)10-7-14-8-12(16-10)15-9-5-3-2-4-6-11(9)17/h7-9,11,17H,2-6H2,1H3,(H,15,16) |
| InChIKey | QNEBTOILAXFBQI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |