C10H14N4O2 — CID 66455769
methyl 6-(pyrrolidin-3-ylamino)pyrazine-2-carboxylate (PubChem CID 66455769) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is methyl 6-(pyrrolidin-3-ylamino)pyrazine-2-carboxylate.
| Compound Name | methyl 6-(pyrrolidin-3-ylamino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66455769 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | methyl 6-(pyrrolidin-3-ylamino)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NC2CCNC2)n1 |
| InChI | InChI=1S/C10H14N4O2/c1-16-10(15)8-5-12-6-9(14-8)13-7-2-3-11-4-7/h5-7,11H,2-4H2,1H3,(H,13,14) |
| InChIKey | KTVGBOMCHBNBFG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |