C13H17N3O3 — CID 63663382
ethyl 6-[(6-oxopiperidin-3-yl)amino]pyridine-3-carboxylate (PubChem CID 63663382) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is ethyl 6-[(6-oxopiperidin-3-yl)amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(6-oxopiperidin-3-yl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 63663382 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | ethyl 6-[(6-oxopiperidin-3-yl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC2CCC(=O)NC2)nc1 |
| InChI | InChI=1S/C13H17N3O3/c1-2-19-13(18)9-3-5-11(14-7-9)16-10-4-6-12(17)15-8-10/h3,5,7,10H,2,4,6,8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | HLMLBQDUMLVZGK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |