C12H16N2O3 — CID 80712830
ethyl 6-(oxolan-3-ylamino)pyridine-3-carboxylate (PubChem CID 80712830) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 6-(oxolan-3-ylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(oxolan-3-ylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 80712830 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl 6-(oxolan-3-ylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC2CCOC2)nc1 |
| InChI | InChI=1S/C12H16N2O3/c1-2-17-12(15)9-3-4-11(13-7-9)14-10-5-6-16-8-10/h3-4,7,10H,2,5-6,8H2,1H3,(H,13,14) |
| InChIKey | HNADDBQNLDXBAR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |