C14H20N2O3 — CID 114075090
ethyl 6-[(4-methyloxan-4-yl)amino]pyridine-3-carboxylate (PubChem CID 114075090) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 6-[(4-methyloxan-4-yl)amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(4-methyloxan-4-yl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 114075090 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | ethyl 6-[(4-methyloxan-4-yl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC2(C)CCOCC2)nc1 |
| InChI | InChI=1S/C14H20N2O3/c1-3-19-13(17)11-4-5-12(15-10-11)16-14(2)6-8-18-9-7-14/h4-5,10H,3,6-9H2,1-2H3,(H,15,16) |
| InChIKey | WENUJBUSSBOLSR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |