C11H15N3O3 — CID 43532828
ethyl 6-[(3-amino-3-oxopropyl)amino]pyridine-3-carboxylate (PubChem CID 43532828) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is ethyl 6-[(3-amino-3-oxopropyl)amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(3-amino-3-oxopropyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 43532828 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | ethyl 6-[(3-amino-3-oxopropyl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCCC(N)=O)nc1 |
| InChI | InChI=1S/C11H15N3O3/c1-2-17-11(16)8-3-4-10(14-7-8)13-6-5-9(12)15/h3-4,7H,2,5-6H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | XOSKKPNXDGFETQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |