C16H17FN2O2 — CID 30059064
ethyl 6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxylate (PubChem CID 30059064) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is ethyl 6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 30059064 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | ethyl 6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCCc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C16H17FN2O2/c1-2-21-16(20)13-5-8-15(19-11-13)18-10-9-12-3-6-14(17)7-4-12/h3-8,11H,2,9-10H2,1H3,(H,18,19) |
| InChIKey | MHOKLXQGNXHFPX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |