C22H23FN4O — CID 109158671
N-[4-(dimethylamino)phenyl]-6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxamide (PubChem CID 109158671) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109158671 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-6-[2-(4-fluorophenyl)ethylamino]pyridine-3-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(NCCc3ccc(F)cc3)nc2)cc1 |
| InChI | InChI=1S/C22H23FN4O/c1-27(2)20-10-8-19(9-11-20)26-22(28)17-5-12-21(25-15-17)24-14-13-16-3-6-18(23)7-4-16/h3-12,15H,13-14H2,1-2H3,(H,24,25)(H,26,28) |
| InChIKey | LAUMURFAVJHBRD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|