C22H20FN3O3 — CID 109156667
ethyl 4-[[6-[(4-fluorophenyl)methylamino]pyridine-3-carbonyl]amino]benzoate (PubChem CID 109156667) has the molecular formula C22H20FN3O3 and a molecular weight of 393.42 g/mol. Its IUPAC name is ethyl 4-[[6-[(4-fluorophenyl)methylamino]pyridine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[6-[(4-fluorophenyl)methylamino]pyridine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109156667 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 4-[[6-[(4-fluorophenyl)methylamino]pyridine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(NCc3ccc(F)cc3)nc2)cc1 |
| InChI | InChI=1S/C22H20FN3O3/c1-2-29-22(28)16-5-10-19(11-6-16)26-21(27)17-7-12-20(25-14-17)24-13-15-3-8-18(23)9-4-15/h3-12,14H,2,13H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | HAOCHPYWHGWCNY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |