C19H24N4O3 — CID 109153832
ethyl 4-[[6-[2-(dimethylamino)ethylamino]pyridine-3-carbonyl]amino]benzoate (PubChem CID 109153832) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is ethyl 4-[[6-[2-(dimethylamino)ethylamino]pyridine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[6-[2-(dimethylamino)ethylamino]pyridine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109153832 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl 4-[[6-[2-(dimethylamino)ethylamino]pyridine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(NCCN(C)C)nc2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-4-26-19(25)14-5-8-16(9-6-14)22-18(24)15-7-10-17(21-13-15)20-11-12-23(2)3/h5-10,13H,4,11-12H2,1-3H3,(H,20,21)(H,22,24) |
| InChIKey | FRVJAOFKFOFPAI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |