C18H22N4O3 — CID 109262560
ethyl 4-[[2-(diethylamino)pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 109262560) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl 4-[[2-(diethylamino)pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(diethylamino)pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109262560 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethyl 4-[[2-(diethylamino)pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cnc(N(CC)CC)nc2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c1-4-22(5-2)18-19-11-14(12-20-18)16(23)21-15-9-7-13(8-10-15)17(24)25-6-3/h7-12H,4-6H2,1-3H3,(H,21,23) |
| InChIKey | FKABHNRRLOCIGP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |