C18H21N3O3 — CID 48650816
methyl 4-[[6-(diethylamino)pyridine-3-carbonyl]amino]benzoate (PubChem CID 48650816) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 4-[[6-(diethylamino)pyridine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[6-(diethylamino)pyridine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 48650816 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | methyl 4-[[6-(diethylamino)pyridine-3-carbonyl]amino]benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)Nc2ccc(C(=O)OC)cc2)cn1 |
| InChI | InChI=1S/C18H21N3O3/c1-4-21(5-2)16-11-8-14(12-19-16)17(22)20-15-9-6-13(7-10-15)18(23)24-3/h6-12H,4-5H2,1-3H3,(H,20,22) |
| InChIKey | NHSCKHGOALVSDQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |