C16H27N3O2 — CID 111447882
6-(diethylamino)-N-(4-hydroxy-2-methylpentyl)pyridine-3-carboxamide (PubChem CID 111447882) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 6-(diethylamino)-N-(4-hydroxy-2-methylpentyl)pyridine-3-carboxamide.
| Compound Name | 6-(diethylamino)-N-(4-hydroxy-2-methylpentyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111447882 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 6-(diethylamino)-N-(4-hydroxy-2-methylpentyl)pyridine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(C(=O)NCC(C)CC(C)O)cn1 |
| InChI | InChI=1S/C16H27N3O2/c1-5-19(6-2)15-8-7-14(11-17-15)16(21)18-10-12(3)9-13(4)20/h7-8,11-13,20H,5-6,9-10H2,1-4H3,(H,18,21) |
| InChIKey | RWVSDVOEBOPPCW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |