C16H18FN3O — CID 63973943
N-[4-(diethylamino)phenyl]-6-fluoropyridine-3-carboxamide (PubChem CID 63973943) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-6-fluoropyridine-3-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 63973943 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-6-fluoropyridine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(F)nc2)cc1 |
| InChI | InChI=1S/C16H18FN3O/c1-3-20(4-2)14-8-6-13(7-9-14)19-16(21)12-5-10-15(17)18-11-12/h5-11H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | SSWMBMVLXGOOAW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|