C18H23N5O3 — CID 109277253
ethyl 4-[[5-[2-(dimethylamino)ethylcarbamoyl]pyrazin-2-yl]amino]benzoate (PubChem CID 109277253) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 4-[[5-[2-(dimethylamino)ethylcarbamoyl]pyrazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-[2-(dimethylamino)ethylcarbamoyl]pyrazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109277253 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | ethyl 4-[[5-[2-(dimethylamino)ethylcarbamoyl]pyrazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cnc(C(=O)NCCN(C)C)cn2)cc1 |
| InChI | InChI=1S/C18H23N5O3/c1-4-26-18(25)13-5-7-14(8-6-13)22-16-12-20-15(11-21-16)17(24)19-9-10-23(2)3/h5-8,11-12H,4,9-10H2,1-3H3,(H,19,24)(H,21,22) |
| InChIKey | NORLYSNSIRLQBF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |