C17H20N4O4 — CID 109275812
ethyl 4-[[5-(2-methoxyethylcarbamoyl)pyrazin-2-yl]amino]benzoate (PubChem CID 109275812) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is ethyl 4-[[5-(2-methoxyethylcarbamoyl)pyrazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-(2-methoxyethylcarbamoyl)pyrazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109275812 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | ethyl 4-[[5-(2-methoxyethylcarbamoyl)pyrazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cnc(C(=O)NCCOC)cn2)cc1 |
| InChI | InChI=1S/C17H20N4O4/c1-3-25-17(23)12-4-6-13(7-5-12)21-15-11-19-14(10-20-15)16(22)18-8-9-24-2/h4-7,10-11H,3,8-9H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | QMKJMGZNVNOMOA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|