C20H19N5O3 — CID 109283332
ethyl 4-[[5-(pyridin-3-ylmethylcarbamoyl)pyrazin-2-yl]amino]benzoate (PubChem CID 109283332) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is ethyl 4-[[5-(pyridin-3-ylmethylcarbamoyl)pyrazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-(pyridin-3-ylmethylcarbamoyl)pyrazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109283332 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | ethyl 4-[[5-(pyridin-3-ylmethylcarbamoyl)pyrazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cnc(C(=O)NCc3cccnc3)cn2)cc1 |
| InChI | InChI=1S/C20H19N5O3/c1-2-28-20(27)15-5-7-16(8-6-15)25-18-13-22-17(12-23-18)19(26)24-11-14-4-3-9-21-10-14/h3-10,12-13H,2,11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | AUPRTJLOWICOJD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |