C20H27N5O3 — CID 109366834
ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]-2-methylpyrimidin-4-yl]amino]benzoate (PubChem CID 109366834) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]-2-methylpyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]-2-methylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 109366834 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]-2-methylpyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cc(C(=O)NCCCN(C)C)nc(C)n2)cc1 |
| InChI | InChI=1S/C20H27N5O3/c1-5-28-20(27)15-7-9-16(10-8-15)24-18-13-17(22-14(2)23-18)19(26)21-11-6-12-25(3)4/h7-10,13H,5-6,11-12H2,1-4H3,(H,21,26)(H,22,23,24) |
| InChIKey | FFJSZVLAQHYGLB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|