C19H21FN2O3 — CID 108902202
ethyl 4-[[2-(4-fluorophenyl)ethylcarbamoylamino]methyl]benzoate (PubChem CID 108902202) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is ethyl 4-[[2-(4-fluorophenyl)ethylcarbamoylamino]methyl]benzoate.
| Compound Name | ethyl 4-[[2-(4-fluorophenyl)ethylcarbamoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 108902202 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | ethyl 4-[[2-(4-fluorophenyl)ethylcarbamoylamino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN2O3/c1-2-25-18(23)16-7-3-15(4-8-16)13-22-19(24)21-12-11-14-5-9-17(20)10-6-14/h3-10H,2,11-13H2,1H3,(H2,21,22,24) |
| InChIKey | FMCXVVMXPOOULS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |